Oxalic acid dihydrate 33506-5KG
Catalog/Part Number:: 33506-5KG
₦593,340.00
Description
General description
Oxalic acid dihydrate crystals are monoclinic and exhibit a space
group P21/n. Each unit cell contains two
molecules. 13C chemical shielding tensors in oxalic acid
dihydrate have been evaluated.[1]
Application
Oxalic acid dihydrate has been used to prepare oxalate precursor, which
was employed for the synthesis of zinc oxide nanopowders.[2] It
may be used to prepare the 0.01M solution of oxalic acid, which was employed in
the mobile phase in liquid chromatographic studies.[3]
Technical Specifications
| Related Categories | Acids, Acids & Bases, Analytical Reagents, Analytical Reagents for General Use, Analytical/Chromatography, |
| Chemical Synthesis, O-P, Puriss p.a. ACS, Organic Acids, Puriss p.a. ACS, Synthetic Reagents | |
| Less... | |
| grade | ACS reagent, reag. ISO, reag. Ph. Eur. |
| vapor density | 4.4 (vs air) |
| vapor pressure | <0.01 mmHg ( 20 °C) |
| grade | puriss. p.a. |
| assay | ≥99.5% (manganometric) |
| impurities | foreign organic matter, in accordance |
| ≤0.001% total nitrogen (N) | |
| ign. residue | ≤0.01% (as SO4) |
| mp | 104-106 °C (lit.) |
| anion traces | chloride (Cl-): ≤5 mg/kg |
| sulfate (SO42-): ≤20 mg/kg | |
| cation traces | Ca: ≤5 mg/kg |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤2 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| heavy metals: ≤5 ppm (by ICP-OES) | |
| SMILES string | [H]O[H].[H]O[H].OC(=O)C(O)=O |
| InChI | 1S/C2H2O4.2H2O/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);2*1H2 |
| InChI key | GEVPUGOOGXGPIO-UHFFFAOYSA-N |
Zero(0) Reviews